C13H18N4O2 — CID 54427891
1-[amino(1,2-oxazolidin-2-yl)methylidene]-3-(2,6-dimethylphenyl)urea (PubChem CID 54427891) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-[amino(1,2-oxazolidin-2-yl)methylidene]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[amino(1,2-oxazolidin-2-yl)methylidene]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 54427891 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-[amino(1,2-oxazolidin-2-yl)methylidene]-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)N=C(N)N1CCCO1 |
| InChI | InChI=1S/C13H18N4O2/c1-9-5-3-6-10(2)11(9)15-13(18)16-12(14)17-7-4-8-19-17/h3,5-6H,4,7-8H2,1-2H3,(H3,14,15,16,18) |
| InChIKey | WFKKHOLCFARCOR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|