C14H19BrN4O — CID 54132765
1-[amino(piperidin-1-yl)methylidene]-3-(2-bromo-6-methylphenyl)urea (PubChem CID 54132765) has the molecular formula C14H19BrN4O and a molecular weight of 339.24 g/mol. Its IUPAC name is 1-[amino(piperidin-1-yl)methylidene]-3-(2-bromo-6-methylphenyl)urea.
| Compound Name | 1-[amino(piperidin-1-yl)methylidene]-3-(2-bromo-6-methylphenyl)urea |
|---|---|
| PubChem CID | 54132765 |
| Molecular Formula | C14H19BrN4O |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-[amino(piperidin-1-yl)methylidene]-3-(2-bromo-6-methylphenyl)urea |
| SMILES | Cc1cccc(Br)c1NC(=O)N=C(N)N1CCCCC1 |
| InChI | InChI=1S/C14H19BrN4O/c1-10-6-5-7-11(15)12(10)17-14(20)18-13(16)19-8-3-2-4-9-19/h5-7H,2-4,8-9H2,1H3,(H3,16,17,18,20) |
| InChIKey | NVNAKTDVPBTJDW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|