C15H26N6 — CID 67865852
2-cyclohexyl-1-(2-methylphenyl)guanidine;guanidine (PubChem CID 67865852) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-cyclohexyl-1-(2-methylphenyl)guanidine;guanidine.
| Compound Name | 2-cyclohexyl-1-(2-methylphenyl)guanidine;guanidine |
|---|---|
| PubChem CID | 67865852 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-cyclohexyl-1-(2-methylphenyl)guanidine;guanidine |
| SMILES | Cc1ccccc1N/C(N)=N/C1CCCCC1.[H]N=C(N)N |
| InChI | InChI=1S/C14H21N3.CH5N3/c1-11-7-5-6-10-13(11)17-14(15)16-12-8-3-2-4-9-12;2-1(3)4/h5-7,10,12H,2-4,8-9H2,1H3,(H3,15,16,17);(H5,2,3,4) |
| InChIKey | DSJKGFAKAAGAMA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|