C18H22N2S — CID 3165867
N'-cyclohexyl-N-(2-methylphenyl)thiophene-2-carboximidamide (PubChem CID 3165867) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N'-cyclohexyl-N-(2-methylphenyl)thiophene-2-carboximidamide.
| Compound Name | N'-cyclohexyl-N-(2-methylphenyl)thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 3165867 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N'-cyclohexyl-N-(2-methylphenyl)thiophene-2-carboximidamide |
| SMILES | Cc1ccccc1N/C(=N/C1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C18H22N2S/c1-14-8-5-6-11-16(14)20-18(17-12-7-13-21-17)19-15-9-3-2-4-10-15/h5-8,11-13,15H,2-4,9-10H2,1H3,(H,19,20) |
| InChIKey | UTNSOJGIYIJOCQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|