C15H20F3NOS — CID 11823339
4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-thiophen-2-ylbutan-2-ol (PubChem CID 11823339) has the molecular formula C15H20F3NOS and a molecular weight of 319.39 g/mol. Its IUPAC name is 4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-thiophen-2-ylbutan-2-ol.
| Compound Name | 4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-thiophen-2-ylbutan-2-ol |
|---|---|
| PubChem CID | 11823339 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-cyclohexylimino-1,1,1-trifluoro-2-methyl-4-thiophen-2-ylbutan-2-ol |
| SMILES | CC(O)(C/C(=N\C1CCCCC1)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C15H20F3NOS/c1-14(20,15(16,17)18)10-12(13-8-5-9-21-13)19-11-6-3-2-4-7-11/h5,8-9,11,20H,2-4,6-7,10H2,1H3/b19-12+ |
| InChIKey | GKRICYQBARJCPC-XDHOZWIPSA-N |
| XLogP | 4.57 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|