C18H29N2O+ — CID 7450690
cyclohexyl-[(2S)-3-methyl-1-(2-methylanilino)-1-oxobutan-2-yl]azanium (PubChem CID 7450690) has the molecular formula C18H29N2O+ and a molecular weight of 289.44 g/mol. Its IUPAC name is cyclohexyl-[(2S)-3-methyl-1-(2-methylanilino)-1-oxobutan-2-yl]azanium.
| Compound Name | cyclohexyl-[(2S)-3-methyl-1-(2-methylanilino)-1-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 7450690 |
| Molecular Formula | C18H29N2O+ |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | cyclohexyl-[(2S)-3-methyl-1-(2-methylanilino)-1-oxobutan-2-yl]azanium |
| SMILES | Cc1ccccc1NC(=O)[C@@H]([NH2+]C1CCCCC1)C(C)C |
| InChI | InChI=1S/C18H28N2O/c1-13(2)17(19-15-10-5-4-6-11-15)18(21)20-16-12-8-7-9-14(16)3/h7-9,12-13,15,17,19H,4-6,10-11H2,1-3H3,(H,20,21)/p+1/t17-/m0/s1 |
| InChIKey | PYVGUUWPKLATOD-KRWDZBQOSA-O |
| XLogP | 2.85 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |