C15H21N3 — CID 124918230
2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-methylphenyl)guanidine (PubChem CID 124918230) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-methylphenyl)guanidine.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-methylphenyl)guanidine |
|---|---|
| PubChem CID | 124918230 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-methylphenyl)guanidine |
| SMILES | Cc1ccccc1N/C(N)=N/[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H21N3/c1-10-4-2-3-5-13(10)17-15(16)18-14-9-11-6-7-12(14)8-11/h2-5,11-12,14H,6-9H2,1H3,(H3,16,17,18)/t11-,12-,14-/m0/s1 |
| InChIKey | GBOCJNIKJDWPIB-OBJOEFQTSA-N |
| XLogP | 2.91 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|