C14H18ClN5S — CID 45263045
2-cyclobutyl-1-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (PubChem CID 45263045) has the molecular formula C14H18ClN5S and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-cyclobutyl-1-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 2-cyclobutyl-1-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 45263045 |
| Molecular Formula | C14H18ClN5S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-cyclobutyl-1-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cc1ccccc1-c1nnc(N/C(N)=N/C2CCC2)s1.Cl |
| InChI | InChI=1S/C14H17N5S.ClH/c1-9-5-2-3-8-11(9)12-18-19-14(20-12)17-13(15)16-10-6-4-7-10;/h2-3,5,8,10H,4,6-7H2,1H3,(H3,15,16,17,19);1H |
| InChIKey | ABSRMCIGNRXCOZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|