C12H14N2 — CID 121011428
(Z)-3-(2,6-dimethylanilino)but-2-enenitrile (PubChem CID 121011428) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is (Z)-3-(2,6-dimethylanilino)but-2-enenitrile.
| Compound Name | (Z)-3-(2,6-dimethylanilino)but-2-enenitrile |
|---|---|
| PubChem CID | 121011428 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (Z)-3-(2,6-dimethylanilino)but-2-enenitrile |
| SMILES | C/C(=C/C#N)Nc1c(C)cccc1C |
| InChI | InChI=1S/C12H14N2/c1-9-5-4-6-10(2)12(9)14-11(3)7-8-13/h4-7,14H,1-3H3/b11-7- |
| InChIKey | HQPLWNGEZASUGX-XFFZJAGNSA-N |
| XLogP | 3.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|