C13H11N5 — CID 168607866
2-[3-methyl-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607866) has the molecular formula C13H11N5 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-[3-methyl-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-methyl-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607866 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[3-methyl-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CNc1c(C)cccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C13H11N5/c1-9-4-3-5-11(13(9)17-2)18-12(8-16)10(6-14)7-15/h3-5,17-18H,1-2H3 |
| InChIKey | RWHFQKFHUWNHBH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|