C11H12N2OS — CID 5061616
[2-(2,6-dimethylanilino)-2-oxoethyl] thiocyanate (PubChem CID 5061616) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] thiocyanate.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] thiocyanate |
|---|---|
| PubChem CID | 5061616 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] thiocyanate |
| SMILES | Cc1cccc(C)c1NC(=O)CSC#N |
| InChI | InChI=1S/C11H12N2OS/c1-8-4-3-5-9(2)11(8)13-10(14)6-15-7-12/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | BZLGVTOEGZHZPP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|