C14H19NOS — CID 71878062
2-but-2-enylsulfanyl-N-(2,6-dimethylphenyl)acetamide (PubChem CID 71878062) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-but-2-enylsulfanyl-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-but-2-enylsulfanyl-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 71878062 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-but-2-enylsulfanyl-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CC=CCSCC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H19NOS/c1-4-5-9-17-10-13(16)15-14-11(2)7-6-8-12(14)3/h4-8H,9-10H2,1-3H3,(H,15,16) |
| InChIKey | QMTHTUIZWIVNHS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|