C22H27N3O3S — CID 18289045
3-[[2-[4-(2,6-dimethylanilino)-4-oxobutyl]sulfanylacetyl]amino]-N-methylbenzamide (PubChem CID 18289045) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-[[2-[4-(2,6-dimethylanilino)-4-oxobutyl]sulfanylacetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-[4-(2,6-dimethylanilino)-4-oxobutyl]sulfanylacetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 18289045 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-[[2-[4-(2,6-dimethylanilino)-4-oxobutyl]sulfanylacetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CSCCCC(=O)Nc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C22H27N3O3S/c1-15-7-4-8-16(2)21(15)25-19(26)11-6-12-29-14-20(27)24-18-10-5-9-17(13-18)22(28)23-3/h4-5,7-10,13H,6,11-12,14H2,1-3H3,(H,23,28)(H,24,27)(H,25,26) |
| InChIKey | AYLNEGOWECNVSZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|