C21H23F3N2O3S — CID 31090338
N-(2,6-dimethylphenyl)-4-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylbutanamide (PubChem CID 31090338) has the molecular formula C21H23F3N2O3S and a molecular weight of 440.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylbutanamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 31090338 |
| Molecular Formula | C21H23F3N2O3S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylbutanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCSCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N2O3S/c1-14-5-3-6-15(2)20(14)26-18(27)7-4-12-30-13-19(28)25-16-8-10-17(11-9-16)29-21(22,23)24/h3,5-6,8-11H,4,7,12-13H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | GEDKEEKBCLCYJU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|