C15H22N2OS2 — CID 2842840
[2-(2,6-dimethylanilino)-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 2842840) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 2842840 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C15H22N2OS2/c1-5-17(6-2)15(19)20-10-13(18)16-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,16,18) |
| InChIKey | VVQNCKALBJLFOF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|