C19H30N2OS2 — CID 8818430
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8818430) has the molecular formula C19H30N2OS2 and a molecular weight of 366.60 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818430 |
| Molecular Formula | C19H30N2OS2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H30N2OS2/c1-7-21(8-2)19(23)24-12-17(22)20-18-15(13(3)4)10-9-11-16(18)14(5)6/h9-11,13-14H,7-8,12H2,1-6H3,(H,20,22) |
| InChIKey | NYMGVZZNIBZSEQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|