C17H25N3O2S2 — CID 9490918
[2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 9490918) has the molecular formula C17H25N3O2S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 9490918 |
| Molecular Formula | C17H25N3O2S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)CSC(=S)N(CC)CC |
| InChI | InChI=1S/C17H25N3O2S2/c1-4-13-9-7-8-10-14(13)19-15(21)11-18-16(22)12-24-17(23)20(5-2)6-3/h7-10H,4-6,11-12H2,1-3H3,(H,18,22)(H,19,21) |
| InChIKey | RRIRWQSKTAGWLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|