C19H28N2O3S — CID 58406222
S-[2-(2-ethylanilino)-2-oxoethyl] 2-[[(3R)-3,4-dimethylpentanoyl]amino]ethanethioate (PubChem CID 58406222) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is S-[2-(2-ethylanilino)-2-oxoethyl] 2-[[(3R)-3,4-dimethylpentanoyl]amino]ethanethioate.
| Compound Name | S-[2-(2-ethylanilino)-2-oxoethyl] 2-[[(3R)-3,4-dimethylpentanoyl]amino]ethanethioate |
|---|---|
| PubChem CID | 58406222 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | S-[2-(2-ethylanilino)-2-oxoethyl] 2-[[(3R)-3,4-dimethylpentanoyl]amino]ethanethioate |
| SMILES | CCc1ccccc1NC(=O)CSC(=O)CNC(=O)C[C@@H](C)C(C)C |
| InChI | InChI=1S/C19H28N2O3S/c1-5-15-8-6-7-9-16(15)21-18(23)12-25-19(24)11-20-17(22)10-14(4)13(2)3/h6-9,13-14H,5,10-12H2,1-4H3,(H,20,22)(H,21,23)/t14-/m1/s1 |
| InChIKey | KSGHZLLFKMEOPW-CQSZACIVSA-N |
| XLogP | 3.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|