C14H22N2OS — CID 2804506
methyl N-(2,6-dimethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidothioate (PubChem CID 2804506) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is methyl N-(2,6-dimethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidothioate.
| Compound Name | methyl N-(2,6-dimethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidothioate |
|---|---|
| PubChem CID | 2804506 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl N-(2,6-dimethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidothioate |
| SMILES | CS/C(=N\C(C)(C)CO)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N2OS/c1-10-7-6-8-11(2)12(10)15-13(18-5)16-14(3,4)9-17/h6-8,17H,9H2,1-5H3,(H,15,16) |
| InChIKey | YSUYBCCGAFHBNU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|