C19H24O2 — CID 23292671
2,2-bis(2,6-dimethylphenyl)propane-1,3-diol (PubChem CID 23292671) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,2-bis(2,6-dimethylphenyl)propane-1,3-diol.
| Compound Name | 2,2-bis(2,6-dimethylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 23292671 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2,2-bis(2,6-dimethylphenyl)propane-1,3-diol |
| SMILES | Cc1cccc(C)c1C(CO)(CO)c1c(C)cccc1C |
| InChI | InChI=1S/C19H24O2/c1-13-7-5-8-14(2)17(13)19(11-20,12-21)18-15(3)9-6-10-16(18)4/h5-10,20-21H,11-12H2,1-4H3 |
| InChIKey | UWVTUARFJRHKCW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |