C13H20IN3S — CID 2768580
[[(2,6-dimethylanilino)-methylsulfanylmethylidene]amino]methylidene-dimethylazanium iodide (PubChem CID 2768580) has the molecular formula C13H20IN3S and a molecular weight of 377.30 g/mol. Its IUPAC name is [[(2,6-dimethylanilino)-methylsulfanylmethylidene]amino]methylidene-dimethylazanium iodide.
| Compound Name | [[(2,6-dimethylanilino)-methylsulfanylmethylidene]amino]methylidene-dimethylazanium iodide |
|---|---|
| PubChem CID | 2768580 |
| Molecular Formula | C13H20IN3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [[(2,6-dimethylanilino)-methylsulfanylmethylidene]amino]methylidene-dimethylazanium iodide |
| SMILES | CS/C(=N\C=[N+](C)C)Nc1c(C)cccc1C.[I-] |
| InChI | InChI=1S/C13H19N3S.HI/c1-10-7-6-8-11(2)12(10)15-13(17-5)14-9-16(3)4;/h6-9H,1-5H3;1H |
| InChIKey | INMJDTDNLSUABM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|