C26H38N4S2 — CID 137436480
methyl N-(2,6-dimethylphenyl)-N'-[5-[[methylsulfanyl-(2,3,6-trimethylanilino)methylidene]amino]pentyl]carbamimidothioate (PubChem CID 137436480) has the molecular formula C26H38N4S2 and a molecular weight of 470.75 g/mol. Its IUPAC name is methyl N-(2,6-dimethylphenyl)-N'-[5-[[methylsulfanyl-(2,3,6-trimethylanilino)methylidene]amino]pentyl]carbamimidothioate.
| Compound Name | methyl N-(2,6-dimethylphenyl)-N'-[5-[[methylsulfanyl-(2,3,6-trimethylanilino)methylidene]amino]pentyl]carbamimidothioate |
|---|---|
| PubChem CID | 137436480 |
| Molecular Formula | C26H38N4S2 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | methyl N-(2,6-dimethylphenyl)-N'-[5-[[methylsulfanyl-(2,3,6-trimethylanilino)methylidene]amino]pentyl]carbamimidothioate |
| SMILES | CS/C(=N\CCCCC/N=C(/Nc1c(C)ccc(C)c1C)SC)Nc1c(C)cccc1C |
| InChI | InChI=1S/C26H38N4S2/c1-18-14-15-21(4)24(22(18)5)30-26(32-7)28-17-10-8-9-16-27-25(31-6)29-23-19(2)12-11-13-20(23)3/h11-15H,8-10,16-17H2,1-7H3,(H,27,29)(H,28,30) |
| InChIKey | IPFPAZFTUPOMPE-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|