C11H15N — CID 138555327
(2E,4Z)-N,4-bis(ethenyl)hepta-2,4,6-trien-3-amine (PubChem CID 138555327) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (2E,4Z)-N,4-bis(ethenyl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N,4-bis(ethenyl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 138555327 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (2E,4Z)-N,4-bis(ethenyl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(C=C)\C(=C/C)NC=C |
| InChI | InChI=1S/C11H15N/c1-5-9-10(6-2)11(7-3)12-8-4/h5-9,12H,1-2,4H2,3H3/b10-9-,11-7+ |
| InChIKey | RKHGPDVQUWQVBK-IRLYEXJDSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|