C8H14BrN — CID 143004877
(Z)-N-[(1E)-1-bromobuta-1,3-dienyl]ethanimine;ethane (PubChem CID 143004877) has the molecular formula C8H14BrN and a molecular weight of 204.11 g/mol. Its IUPAC name is (Z)-N-[(1E)-1-bromobuta-1,3-dienyl]ethanimine;ethane.
| Compound Name | (Z)-N-[(1E)-1-bromobuta-1,3-dienyl]ethanimine;ethane |
|---|---|
| PubChem CID | 143004877 |
| Molecular Formula | C8H14BrN |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | (Z)-N-[(1E)-1-bromobuta-1,3-dienyl]ethanimine;ethane |
| SMILES | C=C/C=C(Br)\N=C/C.CC |
| InChI | InChI=1S/C6H8BrN.C2H6/c1-3-5-6(7)8-4-2;1-2/h3-5H,1H2,2H3;1-2H3/b6-5-,8-4-; |
| InChIKey | VHYYUDRDWGQHQG-ACOODEMNSA-N |
| XLogP | 3.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|