C10H17BrO — CID 143124692
(2Z,3E)-3-bromo-2-ethylidenehexa-3,5-dien-1-ol;ethane (PubChem CID 143124692) has the molecular formula C10H17BrO and a molecular weight of 233.15 g/mol. Its IUPAC name is (2Z,3E)-3-bromo-2-ethylidenehexa-3,5-dien-1-ol;ethane.
| Compound Name | (2Z,3E)-3-bromo-2-ethylidenehexa-3,5-dien-1-ol;ethane |
|---|---|
| PubChem CID | 143124692 |
| Molecular Formula | C10H17BrO |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (2Z,3E)-3-bromo-2-ethylidenehexa-3,5-dien-1-ol;ethane |
| SMILES | C=C/C=C(Br)\C(=C/C)CO.CC |
| InChI | InChI=1S/C8H11BrO.C2H6/c1-3-5-8(9)7(4-2)6-10;1-2/h3-5,10H,1,6H2,2H3;1-2H3/b7-4-,8-5+; |
| InChIKey | VUTDUKSPFIQLLT-QMKOBIDDSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|