C8H11NO3 — CID 143808587
(2E)-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dien-1-ol (PubChem CID 143808587) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is (2E)-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dien-1-ol.
| Compound Name | (2E)-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 143808587 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (2E)-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dien-1-ol |
| SMILES | C=C/C=C(CO)\C(=C/C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H11NO3/c1-3-5-7(6-10)8(4-2)9(11)12/h3-5,10H,1,6H2,2H3/b7-5-,8-4+ |
| InChIKey | HMATWJFDNAMBFZ-DZAKWUEVSA-N |
| XLogP | 1.27 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|