C8H13NO3 — CID 91460463
4-methoxy-3-nitrohepta-2,4-diene (PubChem CID 91460463) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-methoxy-3-nitrohepta-2,4-diene.
| Compound Name | 4-methoxy-3-nitrohepta-2,4-diene |
|---|---|
| PubChem CID | 91460463 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4-methoxy-3-nitrohepta-2,4-diene |
| SMILES | CC=C(C(=CCC)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO3/c1-4-6-8(12-3)7(5-2)9(10)11/h5-6H,4H2,1-3H3 |
| InChIKey | PTYJCRFAKTUSFA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|