C14H17N3O4 — CID 155574552
methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate (PubChem CID 155574552) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155574552 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate |
| SMILES | C/C=C(C(=C/CC)\Nc1ccc(C(=O)OC)cn1)/[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O4/c1-4-6-11(12(5-2)17(19)20)16-13-8-7-10(9-15-13)14(18)21-3/h5-9H,4H2,1-3H3,(H,15,16)/b11-6+,12-5+ |
| InChIKey | AWOLIAMBGJWHPR-HFQMJBPSSA-N |
| XLogP | 2.75 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|