About methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate
methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate (PubChem CID 155574552) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate |
| PubChem CID | 155574552 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate |
| SMILES | C/C=C(C(=C/CC)\Nc1ccc(C(=O)OC)cn1)/[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O4/c1-4-6-11(12(5-2)17(19)20)16-13-8-7-10(9-15-13)14(18)21-3/h5-9H,4H2,1-3H3,(H,15,16)/b11-6+,12-5+ |
| InChIKey | AWOLIAMBGJWHPR-HFQMJBPSSA-N |
| XLogP | 2.75 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate?
The IUPAC name of methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate (CID 155574552) is methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate is C/C=C(C(=C/CC)\Nc1ccc(C(=O)OC)cn1)/[N+](=O)[O-].
What is the InChIKey of methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate?
The InChIKey is AWOLIAMBGJWHPR-HFQMJBPSSA-N. The full InChI is InChI=1S/C14H17N3O4/c1-4-6-11(12(5-2)17(19)20)16-13-8-7-10(9-15-13)14(18)21-3/h5-9H,4H2,1-3H3,(H,15,16)/b11-6+,12-5+.
What are the key properties of methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate?
methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate has a molecular weight of 291.31 g/mol, XLogP of 2.75, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[(2E,4E)-3-nitrohepta-2,4-dien-4-yl]amino]pyridine-3-carboxylate is sourced from PubChem (CID 155574552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).