C16H17N5O4 — CID 118712299
methyl 2-[[6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]pyridine-4-carboxylate (PubChem CID 118712299) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is methyl 2-[[6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]pyridine-4-carboxylate.
| Compound Name | methyl 2-[[6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118712299 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl 2-[[6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]pyridine-4-carboxylate |
| SMILES | CCNC(=O)Nc1ccc(C(=O)Nc2cc(C(=O)OC)ccn2)cn1 |
| InChI | InChI=1S/C16H17N5O4/c1-3-17-16(24)21-12-5-4-11(9-19-12)14(22)20-13-8-10(6-7-18-13)15(23)25-2/h4-9H,3H2,1-2H3,(H,18,20,22)(H2,17,19,21,24) |
| InChIKey | PFEBZZSWMOFVHT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |