C10H12BrN3O3 — CID 143854974
methyl 2-(1-bromoethylcarbamoylamino)pyridine-4-carboxylate (PubChem CID 143854974) has the molecular formula C10H12BrN3O3 and a molecular weight of 302.13 g/mol. Its IUPAC name is methyl 2-(1-bromoethylcarbamoylamino)pyridine-4-carboxylate.
| Compound Name | methyl 2-(1-bromoethylcarbamoylamino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 143854974 |
| Molecular Formula | C10H12BrN3O3 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | methyl 2-(1-bromoethylcarbamoylamino)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(NC(=O)NC(C)Br)c1 |
| InChI | InChI=1S/C10H12BrN3O3/c1-6(11)13-10(16)14-8-5-7(3-4-12-8)9(15)17-2/h3-6H,1-2H3,(H2,12,13,14,16) |
| InChIKey | OPAWLEVYOMKPAL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|