C11H19N3O — CID 170575881
ethane;1-ethyl-3-(4-methyl-2-pyridinyl)urea (PubChem CID 170575881) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is ethane;1-ethyl-3-(4-methyl-2-pyridinyl)urea.
| Compound Name | ethane;1-ethyl-3-(4-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 170575881 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | ethane;1-ethyl-3-(4-methyl-2-pyridinyl)urea |
| SMILES | CC.CCNC(=O)Nc1cc(C)ccn1 |
| InChI | InChI=1S/C9H13N3O.C2H6/c1-3-10-9(13)12-8-6-7(2)4-5-11-8;1-2/h4-6H,3H2,1-2H3,(H2,10,11,12,13);1-2H3 |
| InChIKey | LGTATVZTQNXRGW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |