C19H24N2O4 — CID 649583
3,4,5-triethoxy-N-(4-methyl-2-pyridinyl)benzamide (PubChem CID 649583) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(4-methyl-2-pyridinyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(4-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 649583 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3,4,5-triethoxy-N-(4-methyl-2-pyridinyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cc(C)ccn2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H24N2O4/c1-5-23-15-11-14(12-16(24-6-2)18(15)25-7-3)19(22)21-17-10-13(4)8-9-20-17/h8-12H,5-7H2,1-4H3,(H,20,21,22) |
| InChIKey | VFRMRZIUTCLEDD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |