C18H21IN2O4 — CID 2232052
3,4,5-triethoxy-N-(5-iodo-2-pyridinyl)benzamide (PubChem CID 2232052) has the molecular formula C18H21IN2O4 and a molecular weight of 456.28 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(5-iodo-2-pyridinyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(5-iodo-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 2232052 |
| Molecular Formula | C18H21IN2O4 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 3,4,5-triethoxy-N-(5-iodo-2-pyridinyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(I)cn2)cc(OCC)c1OCC |
| InChI | InChI=1S/C18H21IN2O4/c1-4-23-14-9-12(10-15(24-5-2)17(14)25-6-3)18(22)21-16-8-7-13(19)11-20-16/h7-11H,4-6H2,1-3H3,(H,20,21,22) |
| InChIKey | MIEKRYHKVOXQFS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|