C21H25NO6 — CID 75401141
N-(5-acetyl-2-hydroxyphenyl)-3,4,5-triethoxybenzamide (PubChem CID 75401141) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is N-(5-acetyl-2-hydroxyphenyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(5-acetyl-2-hydroxyphenyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 75401141 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-(5-acetyl-2-hydroxyphenyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cc(C(C)=O)ccc2O)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H25NO6/c1-5-26-18-11-15(12-19(27-6-2)20(18)28-7-3)21(25)22-16-10-14(13(4)23)8-9-17(16)24/h8-12,24H,5-7H2,1-4H3,(H,22,25) |
| InChIKey | FERLQMDGTHJYKU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|