C18H22N2O5 — CID 18109391
3,4,5-triethoxy-N-(3-hydroxy-2-pyridinyl)benzamide (PubChem CID 18109391) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(3-hydroxy-2-pyridinyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(3-hydroxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 18109391 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3,4,5-triethoxy-N-(3-hydroxy-2-pyridinyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ncccc2O)cc(OCC)c1OCC |
| InChI | InChI=1S/C18H22N2O5/c1-4-23-14-10-12(11-15(24-5-2)16(14)25-6-3)18(22)20-17-13(21)8-7-9-19-17/h7-11,21H,4-6H2,1-3H3,(H,19,20,22) |
| InChIKey | KCHOTRPVEFEQKM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |