C21H28N2O5 — CID 30832504
3,4,5-triethoxy-N-[(2-ethoxy-3-pyridinyl)methyl]benzamide (PubChem CID 30832504) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(2-ethoxy-3-pyridinyl)methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(2-ethoxy-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 30832504 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 3,4,5-triethoxy-N-[(2-ethoxy-3-pyridinyl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCc2cccnc2OCC)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H28N2O5/c1-5-25-17-12-16(13-18(26-6-2)19(17)27-7-3)20(24)23-14-15-10-9-11-22-21(15)28-8-4/h9-13H,5-8,14H2,1-4H3,(H,23,24) |
| InChIKey | PGDLQXSBGFKHNB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |