C17H18N2O3 — CID 12847830
[3-[[(3,5-dimethylbenzoyl)amino]methyl]-2-pyridinyl] acetate (PubChem CID 12847830) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is [3-[[(3,5-dimethylbenzoyl)amino]methyl]-2-pyridinyl] acetate.
| Compound Name | [3-[[(3,5-dimethylbenzoyl)amino]methyl]-2-pyridinyl] acetate |
|---|---|
| PubChem CID | 12847830 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [3-[[(3,5-dimethylbenzoyl)amino]methyl]-2-pyridinyl] acetate |
| SMILES | CC(=O)Oc1ncccc1CNC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-11-7-12(2)9-15(8-11)16(21)19-10-14-5-4-6-18-17(14)22-13(3)20/h4-9H,10H2,1-3H3,(H,19,21) |
| InChIKey | WWTZPTDSPPVBCE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |