C22H24N2O4 — CID 1018003
3,4,5-triethoxy-N-quinolin-8-ylbenzamide (PubChem CID 1018003) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-quinolin-8-ylbenzamide.
| Compound Name | 3,4,5-triethoxy-N-quinolin-8-ylbenzamide |
|---|---|
| PubChem CID | 1018003 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3,4,5-triethoxy-N-quinolin-8-ylbenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc3cccnc23)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H24N2O4/c1-4-26-18-13-16(14-19(27-5-2)21(18)28-6-3)22(25)24-17-11-7-9-15-10-8-12-23-20(15)17/h7-14H,4-6H2,1-3H3,(H,24,25) |
| InChIKey | SJSALCCZOZQUQH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |