C19H16Cl2N2O2 — CID 39867044
3,5-dichloro-4-propoxy-N-quinolin-8-ylbenzamide (PubChem CID 39867044) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 3,5-dichloro-4-propoxy-N-quinolin-8-ylbenzamide.
| Compound Name | 3,5-dichloro-4-propoxy-N-quinolin-8-ylbenzamide |
|---|---|
| PubChem CID | 39867044 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3,5-dichloro-4-propoxy-N-quinolin-8-ylbenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2cccc3cccnc23)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-2-9-25-18-14(20)10-13(11-15(18)21)19(24)23-16-7-3-5-12-6-4-8-22-17(12)16/h3-8,10-11H,2,9H2,1H3,(H,23,24) |
| InChIKey | NQSUWVMPEDYBEO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |