C20H29N3O4 — CID 78778639
N-(2-butan-2-ylpyrazol-3-yl)-3,4,5-triethoxybenzamide (PubChem CID 78778639) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(2-butan-2-ylpyrazol-3-yl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(2-butan-2-ylpyrazol-3-yl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 78778639 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-(2-butan-2-ylpyrazol-3-yl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccnn2C(C)CC)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H29N3O4/c1-6-14(5)23-18(10-11-21-23)22-20(24)15-12-16(25-7-2)19(27-9-4)17(13-15)26-8-3/h10-14H,6-9H2,1-5H3,(H,22,24) |
| InChIKey | LSYVQOPMMAXCQQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |