C15H17F2N3OS — CID 134025818
N-(2-butan-2-ylpyrazol-3-yl)-4-(difluoromethylsulfanyl)benzamide (PubChem CID 134025818) has the molecular formula C15H17F2N3OS and a molecular weight of 325.38 g/mol. Its IUPAC name is N-(2-butan-2-ylpyrazol-3-yl)-4-(difluoromethylsulfanyl)benzamide.
| Compound Name | N-(2-butan-2-ylpyrazol-3-yl)-4-(difluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 134025818 |
| Molecular Formula | C15H17F2N3OS |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(2-butan-2-ylpyrazol-3-yl)-4-(difluoromethylsulfanyl)benzamide |
| SMILES | CCC(C)n1nccc1NC(=O)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H17F2N3OS/c1-3-10(2)20-13(8-9-18-20)19-14(21)11-4-6-12(7-5-11)22-15(16)17/h4-10,15H,3H2,1-2H3,(H,19,21) |
| InChIKey | JHMXXCLRZVFOJH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |