C15H17Cl2N3O2 — CID 134049613
N-(2-butan-2-ylpyrazol-3-yl)-3,5-dichloro-4-methoxybenzamide (PubChem CID 134049613) has the molecular formula C15H17Cl2N3O2 and a molecular weight of 342.23 g/mol. Its IUPAC name is N-(2-butan-2-ylpyrazol-3-yl)-3,5-dichloro-4-methoxybenzamide.
| Compound Name | N-(2-butan-2-ylpyrazol-3-yl)-3,5-dichloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 134049613 |
| Molecular Formula | C15H17Cl2N3O2 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-(2-butan-2-ylpyrazol-3-yl)-3,5-dichloro-4-methoxybenzamide |
| SMILES | CCC(C)n1nccc1NC(=O)c1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2N3O2/c1-4-9(2)20-13(5-6-18-20)19-15(21)10-7-11(16)14(22-3)12(17)8-10/h5-9H,4H2,1-3H3,(H,19,21) |
| InChIKey | LHRQYLNFUNBXPM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |