C18H21N5O3 — CID 78829285
N-(2-butan-2-ylpyrazol-3-yl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 78829285) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-(2-butan-2-ylpyrazol-3-yl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-(2-butan-2-ylpyrazol-3-yl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78829285 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(2-butan-2-ylpyrazol-3-yl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | CCC(C)n1nccc1NC(=O)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C18H21N5O3/c1-3-12(2)23-15(8-9-20-23)21-17(25)14-6-4-13(5-7-14)11-22-16(24)10-19-18(22)26/h4-9,12H,3,10-11H2,1-2H3,(H,19,26)(H,21,25) |
| InChIKey | BYIOVWMSYCRIMU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|