C19H25N3O3 — CID 18775613
N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-3,4-diethoxybenzamide (PubChem CID 18775613) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 18775613 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccnn2C(C)C2CC2)cc1OCC |
| InChI | InChI=1S/C19H25N3O3/c1-4-24-16-9-8-15(12-17(16)25-5-2)19(23)21-18-10-11-20-22(18)13(3)14-6-7-14/h8-14H,4-7H2,1-3H3,(H,21,23) |
| InChIKey | CNYZDJOVFKPNHR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |