C16H22O3 — CID 83154555
2-cyclopropyl-1-(3,4-diethoxyphenyl)propan-1-one (PubChem CID 83154555) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-cyclopropyl-1-(3,4-diethoxyphenyl)propan-1-one.
| Compound Name | 2-cyclopropyl-1-(3,4-diethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 83154555 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-cyclopropyl-1-(3,4-diethoxyphenyl)propan-1-one |
| SMILES | CCOc1ccc(C(=O)C(C)C2CC2)cc1OCC |
| InChI | InChI=1S/C16H22O3/c1-4-18-14-9-8-13(10-15(14)19-5-2)16(17)11(3)12-6-7-12/h8-12H,4-7H2,1-3H3 |
| InChIKey | AKFINYYYLYIRJK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |