C25H31N3O6 — CID 55435038
N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3,4,5-triethoxybenzamide (PubChem CID 55435038) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 55435038 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccnn2Cc2cccc(OC)c2OC)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H31N3O6/c1-6-32-20-14-18(15-21(33-7-2)24(20)34-8-3)25(29)27-22-12-13-26-28(22)16-17-10-9-11-19(30-4)23(17)31-5/h9-15H,6-8,16H2,1-5H3,(H,27,29) |
| InChIKey | FNQMINUPMJTVAP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |