C19H25N3O3 — CID 51248440
2-cyclopentyl-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 51248440) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 51248440 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-cyclopentyl-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | COc1cccc(Cn2nccc2NC(=O)CC2CCCC2)c1OC |
| InChI | InChI=1S/C19H25N3O3/c1-24-16-9-5-8-15(19(16)25-2)13-22-17(10-11-20-22)21-18(23)12-14-6-3-4-7-14/h5,8-11,14H,3-4,6-7,12-13H2,1-2H3,(H,21,23) |
| InChIKey | SXVGSXKVELQMMT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |