C19H27N3O4 — CID 55687161
N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(2-methylpropoxy)propanamide (PubChem CID 55687161) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(2-methylpropoxy)propanamide.
| Compound Name | N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(2-methylpropoxy)propanamide |
|---|---|
| PubChem CID | 55687161 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(2-methylpropoxy)propanamide |
| SMILES | COc1cccc(Cn2nccc2NC(=O)CCOCC(C)C)c1OC |
| InChI | InChI=1S/C19H27N3O4/c1-14(2)13-26-11-9-18(23)21-17-8-10-20-22(17)12-15-6-5-7-16(24-3)19(15)25-4/h5-8,10,14H,9,11-13H2,1-4H3,(H,21,23) |
| InChIKey | AFUPIYHYVWBPJT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|