C18H26N4O4 — CID 120559352
4-amino-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]pentanamide (PubChem CID 120559352) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-amino-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]pentanamide.
| Compound Name | 4-amino-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]pentanamide |
|---|---|
| PubChem CID | 120559352 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 4-amino-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]pentanamide |
| SMILES | COc1ccc(Cn2nccc2NC(=O)CCC(C)N)c(OC)c1OC |
| InChI | InChI=1S/C18H26N4O4/c1-12(19)5-8-16(23)21-15-9-10-20-22(15)11-13-6-7-14(24-2)18(26-4)17(13)25-3/h6-7,9-10,12H,5,8,11,19H2,1-4H3,(H,21,23) |
| InChIKey | OOTYICMITKZFFE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |