C21H23N3O5 — CID 155909327
2-phenoxy-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 155909327) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-phenoxy-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-phenoxy-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 155909327 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-phenoxy-N-[2-[(2,3,4-trimethoxyphenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | COc1ccc(Cn2nccc2NC(=O)COc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C21H23N3O5/c1-26-17-10-9-15(20(27-2)21(17)28-3)13-24-18(11-12-22-24)23-19(25)14-29-16-7-5-4-6-8-16/h4-12H,13-14H2,1-3H3,(H,23,25) |
| InChIKey | JRRLAYTUAZMNFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |